C18H38O4Si2 — CID 173349445
(4S,6S)-6-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylsilyloxymethyl)oxan-2-one (PubChem CID 173349445) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is (4S,6S)-6-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylsilyloxymethyl)oxan-2-one.
| Compound Name | (4S,6S)-6-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylsilyloxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 173349445 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (4S,6S)-6-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylsilyloxymethyl)oxan-2-one |
| SMILES | C[SiH](C)OCC1C(=O)O[C@H](C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O4Si2/c1-17(2,3)15-11-14(22-24(9,10)18(4,5)6)13(16(19)21-15)12-20-23(7)8/h13-15,23H,11-12H2,1-10H3/t13?,14-,15-/m0/s1 |
| InChIKey | ZFPIGQHREQOBNI-FGRDXJNISA-N |
| XLogP | 4.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|