C21H34O2Si — CID 134885322
(2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-hexa-2,4-diynylcyclopentan-1-one (PubChem CID 134885322) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is (2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-hexa-2,4-diynylcyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-hexa-2,4-diynylcyclopentan-1-one |
|---|---|
| PubChem CID | 134885322 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (2R,3R,4R)-3-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-hexa-2,4-diynylcyclopentan-1-one |
| SMILES | CC#CC#CC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCC |
| InChI | InChI=1S/C21H34O2Si/c1-8-10-12-13-15-17-18(14-11-9-2)20(16-19(17)22)23-24(6,7)21(3,4)5/h17-18,20H,9,11,14-16H2,1-7H3/t17-,18-,20-/m1/s1 |
| InChIKey | KJTNVNRJPBUKIC-QWFCFKBJSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|