C17H35NO2Si — CID 10733992
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-heptan-2-yl]pyrrolidin-2-one (PubChem CID 10733992) has the molecular formula C17H35NO2Si and a molecular weight of 313.56 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-heptan-2-yl]pyrrolidin-2-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-heptan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10733992 |
| Molecular Formula | C17H35NO2Si |
| Molecular Weight | 313.56 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-heptan-2-yl]pyrrolidin-2-one |
| SMILES | CCCCC[C@@H](C)N1C[C@@H](O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C17H35NO2Si/c1-8-9-10-11-14(2)18-13-15(12-16(18)19)20-21(6,7)17(3,4)5/h14-15H,8-13H2,1-7H3/t14-,15+/m1/s1 |
| InChIKey | GAOCODAECBKUGN-CABCVRRESA-N |
| XLogP | 4.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|