C29H56O3Si2 — CID 70506808
4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxynon-1-enyl]-2-prop-2-enylcyclopentan-1-one (PubChem CID 70506808) has the molecular formula C29H56O3Si2 and a molecular weight of 508.94 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxynon-1-enyl]-2-prop-2-enylcyclopentan-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxynon-1-enyl]-2-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 70506808 |
| Molecular Formula | C29H56O3Si2 |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxynon-1-enyl]-2-prop-2-enylcyclopentan-1-one |
| SMILES | C=CCC1C(=O)CC(O[Si](C)(C)C(C)(C)C)C1/C=C/[C@@H](CCCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H56O3Si2/c1-13-15-16-17-19-23(31-33(9,10)28(3,4)5)20-21-25-24(18-14-2)26(30)22-27(25)32-34(11,12)29(6,7)8/h14,20-21,23-25,27H,2,13,15-19,22H2,1,3-12H3/b21-20+/t23-,24?,25?,27?/m1/s1 |
| InChIKey | CMDTWNAYRBMTOC-VAPGVFCNSA-N |
| XLogP | 9.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|