C35H66O6Si2 — CID 10770403
methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate (PubChem CID 10770403) has the molecular formula C35H66O6Si2 and a molecular weight of 639.08 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate |
|---|---|
| PubChem CID | 10770403 |
| Molecular Formula | C35H66O6Si2 |
| Molecular Weight | 639.08 g/mol |
| Exact Mass | 638.44 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate |
| SMILES | CCCC[C@H](C)C[C@@H](/C=C/[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CC(=O)CCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H66O6Si2/c1-14-15-18-26(2)23-28(40-42(10,11)34(3,4)5)21-22-29-30(24-27(36)19-16-17-20-33(38)39-9)31(37)25-32(29)41-43(12,13)35(6,7)8/h21-22,26,28-30,32H,14-20,23-25H2,1-13H3/b22-21+/t26-,28+,29+,30+,32+/m0/s1 |
| InChIKey | VHZQMAKSLLOBCN-NHYHZBCYSA-N |
| XLogP | 9.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.08 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|