C35H66O5SSi2 — CID 18395465
6-[(4R,5S)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 18395465) has the molecular formula C35H66O5SSi2 and a molecular weight of 655.15 g/mol. Its IUPAC name is 6-[(4R,5S)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 18395465 |
| Molecular Formula | C35H66O5SSi2 |
| Molecular Weight | 655.15 g/mol |
| Exact Mass | 654.42 |
| IUPAC Name | 6-[(4R,5S)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCC[C@@H](C)C[C@@H](/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(C(C)=O)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H66O5SSi2/c1-14-15-19-26(2)24-28(39-42(10,11)34(4,5)6)21-22-29-31(40-43(12,13)35(7,8)9)25-30(27(3)36)33(29)41-23-18-16-17-20-32(37)38/h21-22,26,28-29,31H,14-20,23-25H2,1-13H3,(H,37,38)/b22-21+/t26-,28-,29+,31-/m1/s1 |
| InChIKey | GHRUXPXPPMFOTR-ROTNQJGZSA-N |
| XLogP | 10.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.15 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|