C34H63F3O4SSi2 — CID 18395492
6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 18395492) has the molecular formula C34H63F3O4SSi2 and a molecular weight of 681.11 g/mol. Its IUPAC name is 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 18395492 |
| Molecular Formula | C34H63F3O4SSi2 |
| Molecular Weight | 681.11 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCC[C@@H](C)C[C@@H](/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(C(F)(F)F)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H63F3O4SSi2/c1-13-14-18-25(2)23-26(40-43(9,10)32(3,4)5)20-21-27-29(41-44(11,12)33(6,7)8)24-28(34(35,36)37)31(27)42-22-17-15-16-19-30(38)39/h20-21,25-27,29H,13-19,22-24H2,1-12H3,(H,38,39)/b21-20+/t25-,26-,27+,29-/m1/s1 |
| InChIKey | NGKGGTOEPFVLAV-KOSBTOPPSA-N |
| XLogP | 11.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.11 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|