C22H35F3O4S — CID 18395490
6-[(4R,5S)-4,5-dihydroxy-5-[(E,5R)-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 18395490) has the molecular formula C22H35F3O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is 6-[(4R,5S)-4,5-dihydroxy-5-[(E,5R)-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4,5-dihydroxy-5-[(E,5R)-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 18395490 |
| Molecular Formula | C22H35F3O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 6-[(4R,5S)-4,5-dihydroxy-5-[(E,5R)-5-methylnon-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCC[C@@H](C)CC/C=C/[C@@]1(O)C(SCCCCCC(=O)O)=C(C(F)(F)F)C[C@H]1O |
| InChI | InChI=1S/C22H35F3O4S/c1-3-4-10-16(2)11-7-8-13-21(29)18(26)15-17(22(23,24)25)20(21)30-14-9-5-6-12-19(27)28/h8,13,16,18,26,29H,3-7,9-12,14-15H2,1-2H3,(H,27,28)/b13-8+/t16-,18-,21+/m1/s1 |
| InChIKey | HZHNYGQIQPLFST-MQVDPDGMSA-N |
| XLogP | 5.84 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|