C38H76O5Si3 — CID 11527692
(Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 11527692) has the molecular formula C38H76O5Si3 and a molecular weight of 697.28 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11527692 |
| Molecular Formula | C38H76O5Si3 |
| Molecular Weight | 697.28 g/mol |
| Exact Mass | 696.50 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H](C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H76O5Si3/c1-17-18-21-24-30(41-44(11,12)36(2,3)4)27-28-32-31(25-22-19-20-23-26-35(39)40)33(42-45(13,14)37(5,6)7)29-34(32)43-46(15,16)38(8,9)10/h19,22,27-28,30-34H,17-18,20-21,23-26,29H2,1-16H3,(H,39,40)/b22-19-,28-27+/t30-,31-,32+,33-,34+/m0/s1 |
| InChIKey | JZIKDXFZAQYRJI-HGSNSPLXSA-N |
| XLogP | 12.13 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.28 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|