C35H66O7SSi2 — CID 173144662
7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]-5-methylsulfonyloxycyclopentyl]hept-5-enoic acid (PubChem CID 173144662) has the molecular formula C35H66O7SSi2 and a molecular weight of 687.14 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]-5-methylsulfonyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]-5-methylsulfonyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 173144662 |
| Molecular Formula | C35H66O7SSi2 |
| Molecular Weight | 687.14 g/mol |
| Exact Mass | 686.41 |
| IUPAC Name | 7-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]-5-methylsulfonyloxycyclopentyl]hept-5-enoic acid |
| SMILES | CCC1(C(CC=C[C@H]2[C@@H](CC=CCCCC(=O)O)[C@H](OS(C)(=O)=O)C[C@H]2O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C35H66O7SSi2/c1-13-35(24-19-25-35)31(42-45(11,12)34(5,6)7)22-18-21-28-27(20-16-14-15-17-23-32(36)37)29(40-43(8,38)39)26-30(28)41-44(9,10)33(2,3)4/h14,16,18,21,27-31H,13,15,17,19-20,22-26H2,1-12H3,(H,36,37)/t27-,28+,29-,30-,31?/m1/s1 |
| InChIKey | GGFSVCYLRHAPFP-KDZYKOBLSA-N |
| XLogP | 9.48 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.14 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|