C19H32O9S2 — CID 134883771
(Z)-7-[(1R,2R,3S,5R)-2-[(E,3S)-3-hydroxypent-1-enyl]-3,5-bis(methylsulfonyloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 134883771) has the molecular formula C19H32O9S2 and a molecular weight of 468.59 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,5R)-2-[(E,3S)-3-hydroxypent-1-enyl]-3,5-bis(methylsulfonyloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,5R)-2-[(E,3S)-3-hydroxypent-1-enyl]-3,5-bis(methylsulfonyloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 134883771 |
| Molecular Formula | C19H32O9S2 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,5R)-2-[(E,3S)-3-hydroxypent-1-enyl]-3,5-bis(methylsulfonyloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H](OS(C)(=O)=O)C[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C19H32O9S2/c1-4-14(20)11-12-16-15(9-7-5-6-8-10-19(21)22)17(27-29(2,23)24)13-18(16)28-30(3,25)26/h5,7,11-12,14-18,20H,4,6,8-10,13H2,1-3H3,(H,21,22)/b7-5-,12-11+/t14-,15+,16+,17+,18-/m0/s1 |
| InChIKey | DHAWYPFCPIPOBE-NBGGKVTESA-N |
| XLogP | 1.84 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|