C16H28O7S — CID 88643382
(Z)-7-[2-[(1S)-1,2-dihydroxyethyl]-6-methylsulfonyloxycyclohexyl]hept-5-enoic acid (PubChem CID 88643382) has the molecular formula C16H28O7S and a molecular weight of 364.46 g/mol. Its IUPAC name is (Z)-7-[2-[(1S)-1,2-dihydroxyethyl]-6-methylsulfonyloxycyclohexyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[2-[(1S)-1,2-dihydroxyethyl]-6-methylsulfonyloxycyclohexyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88643382 |
| Molecular Formula | C16H28O7S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (Z)-7-[2-[(1S)-1,2-dihydroxyethyl]-6-methylsulfonyloxycyclohexyl]hept-5-enoic acid |
| SMILES | CS(=O)(=O)OC1CCCC([C@H](O)CO)C1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C16H28O7S/c1-24(21,22)23-15-9-6-8-12(14(18)11-17)13(15)7-4-2-3-5-10-16(19)20/h2,4,12-15,17-18H,3,5-11H2,1H3,(H,19,20)/b4-2-/t12?,13?,14-,15?/m1/s1 |
| InChIKey | SSQLNWAGYSQKJX-ICPPYWBDSA-N |
| XLogP | 1.30 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|