C15H24O5S — CID 88657565
(Z)-7-[(1R,2R,3R,4S)-3-methylsulfonyloxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 88657565) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-methylsulfonyloxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-methylsulfonyloxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88657565 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-methylsulfonyloxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | CS(=O)(=O)O[C@@H]1[C@H]2CC[C@H](C2)[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C15H24O5S/c1-21(18,19)20-15-12-9-8-11(10-12)13(15)6-4-2-3-5-7-14(16)17/h2,4,11-13,15H,3,5-10H2,1H3,(H,16,17)/b4-2-/t11-,12+,13-,15-/m1/s1 |
| InChIKey | QWUQMZRXGTYHHU-RNNGARQJSA-N |
| XLogP | 2.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|