C36H66O6Si2 — CID 70273382
(Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 70273382) has the molecular formula C36H66O6Si2 and a molecular weight of 651.09 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70273382 |
| Molecular Formula | C36H66O6Si2 |
| Molecular Weight | 651.09 g/mol |
| Exact Mass | 650.44 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCC1(C(C/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@@H](OC(C)=O)C[C@H]2O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C36H66O6Si2/c1-13-36(24-19-25-36)32(42-44(11,12)35(6,7)8)22-18-21-29-28(20-16-14-15-17-23-33(38)39)30(40-27(2)37)26-31(29)41-43(9,10)34(3,4)5/h14,16,18,21,28-32H,13,15,17,19-20,22-26H2,1-12H3,(H,38,39)/b16-14-,21-18+/t28-,29-,30+,31-,32?/m1/s1 |
| InChIKey | FRMVFTCRCOHBTD-SRHVPXMDSA-N |
| XLogP | 10.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.09 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|