C35H57F3O6Si2 — CID 59905097
(Z)-7-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 59905097) has the molecular formula C35H57F3O6Si2 and a molecular weight of 687.00 g/mol. Its IUPAC name is (Z)-7-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59905097 |
| Molecular Formula | C35H57F3O6Si2 |
| Molecular Weight | 687.00 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | (Z)-7-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(/C=C/[C@H]1C(O)CC(O[Si](C)(C)C(C)(C)C)C1C/C=C\CCCC(=O)O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H57F3O6Si2/c1-33(2,3)45(7,8)43-27(24-42-26-17-15-16-25(22-26)35(36,37)38)20-21-28-29(18-13-11-12-14-19-32(40)41)31(23-30(28)39)44-46(9,10)34(4,5)6/h11,13,15-17,20-22,27-31,39H,12,14,18-19,23-24H2,1-10H3,(H,40,41)/b13-11-,21-20+/t27?,28-,29?,30?,31?/m1/s1 |
| InChIKey | XDCSAXJATPJPAL-NMGAFDPNSA-N |
| XLogP | 9.62 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.00 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|