C30H47F3O4Si2 — CID 59905094
5-[tert-butyl(dimethyl)silyl]oxy-7-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 59905094) has the molecular formula C30H47F3O4Si2 and a molecular weight of 584.87 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-7-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-7-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 59905094 |
| Molecular Formula | C30H47F3O4Si2 |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-7-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC2C(=O)CC1C2/C=C/[C@@H](COc1cccc(C(F)(F)F)c1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H47F3O4Si2/c1-28(2,3)38(7,8)36-22(19-35-21-13-11-12-20(16-21)30(31,32)33)14-15-23-24-18-27(25(23)17-26(24)34)37-39(9,10)29(4,5)6/h11-16,22-25,27H,17-19H2,1-10H3/b15-14+/t22-,23?,24?,25?,27?/m0/s1 |
| InChIKey | LIEYZSWHZQIXKK-LTQNYMJGSA-N |
| XLogP | 8.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|