C18H19F3O4 — CID 148799134
(3aR,6aS)-4-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one (PubChem CID 148799134) has the molecular formula C18H19F3O4 and a molecular weight of 356.34 g/mol. Its IUPAC name is (3aR,6aS)-4-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one.
| Compound Name | (3aR,6aS)-4-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one |
|---|---|
| PubChem CID | 148799134 |
| Molecular Formula | C18H19F3O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (3aR,6aS)-4-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one |
| SMILES | O=C1C[C@@H]2OCC[C@@H]2C1/C=C/[C@@H](O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3O4/c19-18(20,21)11-2-1-3-13(8-11)25-10-12(22)4-5-14-15-6-7-24-17(15)9-16(14)23/h1-5,8,12,14-15,17,22H,6-7,9-10H2/b5-4+/t12-,14?,15-,17+/m1/s1 |
| InChIKey | ONRJLZOXJWNNKQ-HEDMMBTLSA-N |
| XLogP | 3.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|