C24H27F3O5 — CID 67000790
7-[(1R,2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 67000790) has the molecular formula C24H27F3O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000790 |
| Molecular Formula | C24H27F3O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 7-[(1R,2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CC1=CC(=O)[C@H](CC=CCCCC(=O)O)[C@H]1C=CC(O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3O5/c1-16-13-22(29)21(9-4-2-3-5-10-23(30)31)20(16)12-11-18(28)15-32-19-8-6-7-17(14-19)24(25,26)27/h2,4,6-8,11-14,18,20-21,28H,3,5,9-10,15H2,1H3,(H,30,31)/t18?,20-,21+/m0/s1 |
| InChIKey | XYMREDDUNOUGKI-QYAPWVIVSA-N |
| XLogP | 4.96 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|