C27H34O4 — CID 67000903
7-[(1R,2R)-2-[(3S)-5-(2,3-dihydro-1H-inden-2-yl)-3-hydroxypent-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 67000903) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3S)-5-(2,3-dihydro-1H-inden-2-yl)-3-hydroxypent-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[(3S)-5-(2,3-dihydro-1H-inden-2-yl)-3-hydroxypent-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000903 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 7-[(1R,2R)-2-[(3S)-5-(2,3-dihydro-1H-inden-2-yl)-3-hydroxypent-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CC1=CC(=O)[C@H](CC=CCCCC(=O)O)[C@H]1C=C[C@@H](O)CCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C27H34O4/c1-19-16-26(29)25(10-4-2-3-5-11-27(30)31)24(19)15-14-23(28)13-12-20-17-21-8-6-7-9-22(21)18-20/h2,4,6-9,14-16,20,23-25,28H,3,5,10-13,17-18H2,1H3,(H,30,31)/t23-,24-,25+/m0/s1 |
| InChIKey | VSSDAOWIINQZKN-CCDWMCETSA-N |
| XLogP | 5.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|