C27H32O4S — CID 67000062
7-[(1R,2R)-2-[6-(1-benzothiophen-2-yl)-3-hydroxyhex-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 67000062) has the molecular formula C27H32O4S and a molecular weight of 452.62 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[6-(1-benzothiophen-2-yl)-3-hydroxyhex-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[6-(1-benzothiophen-2-yl)-3-hydroxyhex-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000062 |
| Molecular Formula | C27H32O4S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 7-[(1R,2R)-2-[6-(1-benzothiophen-2-yl)-3-hydroxyhex-1-enyl]-3-methyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CC1=CC(=O)[C@H](CC=CCCCC(=O)O)[C@H]1C=CC(O)CCCc1cc2ccccc2s1 |
| InChI | InChI=1S/C27H32O4S/c1-19-17-25(29)24(12-4-2-3-5-14-27(30)31)23(19)16-15-21(28)10-8-11-22-18-20-9-6-7-13-26(20)32-22/h2,4,6-7,9,13,15-18,21,23-24,28H,3,5,8,10-12,14H2,1H3,(H,30,31)/t21?,23-,24+/m0/s1 |
| InChIKey | NOKBOVOALOLKGN-RPFBHVFUSA-N |
| XLogP | 6.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|