C24H26O3S — CID 71011303
(Z)-7-[(1R,5R)-5-[(E)-3-(1-benzothiophen-2-yl)prop-1-enyl]-2-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 71011303) has the molecular formula C24H26O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is (Z)-7-[(1R,5R)-5-[(E)-3-(1-benzothiophen-2-yl)prop-1-enyl]-2-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,5R)-5-[(E)-3-(1-benzothiophen-2-yl)prop-1-enyl]-2-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 71011303 |
| Molecular Formula | C24H26O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (Z)-7-[(1R,5R)-5-[(E)-3-(1-benzothiophen-2-yl)prop-1-enyl]-2-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CC1=CC(=O)[C@H](/C=C/Cc2cc3ccccc3s2)[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C24H26O3S/c1-17-15-22(25)21(20(17)11-4-2-3-5-14-24(26)27)12-8-10-19-16-18-9-6-7-13-23(18)28-19/h2,4,6-9,12-13,15-16,20-21H,3,5,10-11,14H2,1H3,(H,26,27)/b4-2-,12-8+/t20-,21+/m0/s1 |
| InChIKey | WPICUVCHMAMWFG-CSIGARINSA-N |
| XLogP | 5.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|