C24H30O4S — CID 77165238
7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2-methyl-4-oxocyclopent-2-en-1-yl]heptanoic acid (PubChem CID 77165238) has the molecular formula C24H30O4S and a molecular weight of 414.57 g/mol. Its IUPAC name is 7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2-methyl-4-oxocyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2-methyl-4-oxocyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 77165238 |
| Molecular Formula | C24H30O4S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 7-[5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2-methyl-4-oxocyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CC1=CC(=O)C(CCC(O)c2cc3ccccc3s2)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C24H30O4S/c1-16-14-21(26)19(18(16)9-4-2-3-5-11-24(27)28)12-13-20(25)23-15-17-8-6-7-10-22(17)29-23/h6-8,10,14-15,18-20,25H,2-5,9,11-13H2,1H3,(H,27,28) |
| InChIKey | AOZGRHQSHHPIAP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|