C24H28O4S — CID 67000860
7-[(1R,2R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-5-methylidene-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67000860) has the molecular formula C24H28O4S and a molecular weight of 412.55 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-5-methylidene-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-5-methylidene-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000860 |
| Molecular Formula | C24H28O4S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 7-[(1R,2R)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-5-methylidene-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | C=C1CC(=O)[C@H](CCC(O)c2cc3ccccc3s2)[C@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C24H28O4S/c1-16-14-21(26)19(18(16)9-4-2-3-5-11-24(27)28)12-13-20(25)23-15-17-8-6-7-10-22(17)29-23/h2,4,6-8,10,15,18-20,25H,1,3,5,9,11-14H2,(H,27,28)/t18-,19+,20?/m0/s1 |
| InChIKey | KEKBQFVJZWOCMA-ABZYKWASSA-N |
| XLogP | 5.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|