C29H36O5S — CID 67000481
7-[(1R,2R,3R)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 67000481) has the molecular formula C29H36O5S and a molecular weight of 496.67 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000481 |
| Molecular Formula | C29H36O5S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | C=C1C[C@@H](OC2CCCCO2)[C@H](C=C[C@@H](O)c2cc3ccccc3s2)[C@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C29H36O5S/c1-20-18-25(34-29-14-8-9-17-33-29)23(22(20)11-4-2-3-5-13-28(31)32)15-16-24(30)27-19-21-10-6-7-12-26(21)35-27/h2,4,6-7,10,12,15-16,19,22-25,29-30H,1,3,5,8-9,11,13-14,17-18H2,(H,31,32)/t22-,23+,24+,25+,29?/m0/s1 |
| InChIKey | LDKGRXSHVHDIIN-SSNHQAKWSA-N |
| XLogP | 6.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|