C45H54O5SSi — CID 67000642
7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 67000642) has the molecular formula C45H54O5SSi and a molecular weight of 735.08 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000642 |
| Molecular Formula | C45H54O5SSi |
| Molecular Weight | 735.08 g/mol |
| Exact Mass | 734.35 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | C=C1C[C@@H](OC2CCCCO2)[C@H](C=CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2cc3ccccc3s2)[C@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C45H54O5SSi/c1-33-31-40(49-44-27-17-18-30-48-44)38(37(33)24-13-5-6-14-26-43(46)47)28-29-39(42-32-34-19-15-16-25-41(34)51-42)50-52(45(2,3)4,35-20-9-7-10-21-35)36-22-11-8-12-23-36/h5,7-13,15-16,19-23,25,28-29,32,37-40,44H,1,6,14,17-18,24,26-27,30-31H2,2-4H3,(H,46,47)/t37-,38+,39?,40+,44?/m0/s1 |
| InChIKey | LEPZOYPFXATQAU-FMOPMAICSA-N |
| XLogP | 10.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.08 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|