C34H38O4SSi — CID 66999881
(3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 66999881) has the molecular formula C34H38O4SSi and a molecular weight of 570.83 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 66999881 |
| Molecular Formula | C34H38O4SSi |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CC(C)(C)[Si](O[C@H](C=C[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1O)c1cc2ccccc2s1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38O4SSi/c1-34(2,3)40(24-13-6-4-7-14-24,25-15-8-5-9-16-25)38-29(32-20-23-12-10-11-17-31(23)39-32)19-18-26-27-21-33(36)37-30(27)22-28(26)35/h4-20,26-30,33,35-36H,21-22H2,1-3H3/t26-,27-,28-,29-,30+,33?/m1/s1 |
| InChIKey | HADQGLMDSWTTCW-LFPNZXLMSA-N |
| XLogP | 6.18 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|