C39H50O5SSi — CID 77165204
7-[2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 77165204) has the molecular formula C39H50O5SSi and a molecular weight of 658.98 g/mol. Its IUPAC name is 7-[2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 77165204 |
| Molecular Formula | C39H50O5SSi |
| Molecular Weight | 658.98 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | 7-[2-[3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | CC(C)(C)[Si](OC(CCC1C(O)CC(O)C1CCCCCCC(=O)O)c1cc2ccccc2s1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H50O5SSi/c1-39(2,3)46(29-17-8-6-9-18-29,30-19-10-7-11-20-30)44-35(37-26-28-16-14-15-22-36(28)45-37)25-24-32-31(33(40)27-34(32)41)21-12-4-5-13-23-38(42)43/h6-11,14-20,22,26,31-35,40-41H,4-5,12-13,21,23-25,27H2,1-3H3,(H,42,43) |
| InChIKey | YPOFITWUBDEMER-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.98 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|