C27H40O8S — CID 11699316
[(2R,3R)-2,3,4-trihydroxybutyl] 7-[(1R,2R,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 11699316) has the molecular formula C27H40O8S and a molecular weight of 524.68 g/mol. Its IUPAC name is [(2R,3R)-2,3,4-trihydroxybutyl] 7-[(1R,2R,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | [(2R,3R)-2,3,4-trihydroxybutyl] 7-[(1R,2R,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 11699316 |
| Molecular Formula | C27H40O8S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [(2R,3R)-2,3,4-trihydroxybutyl] 7-[(1R,2R,3R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | O=C(CCCCCC[C@@H]1[C@@H](CC[C@@H](O)c2cc3ccccc3s2)[C@H](O)C[C@@H]1O)OC[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C27H40O8S/c28-15-23(32)24(33)16-35-27(34)10-4-2-1-3-8-18-19(22(31)14-21(18)30)11-12-20(29)26-13-17-7-5-6-9-25(17)36-26/h5-7,9,13,18-24,28-33H,1-4,8,10-12,14-16H2/t18-,19-,20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | ULMRCJWCABOZPC-VDRZETLSSA-N |
| XLogP | 2.67 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|