C23H34F2O5 — CID 59075700
ethyl 7-[(1R,2R,3R,5S)-2-[3-(3,5-difluorophenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 59075700) has the molecular formula C23H34F2O5 and a molecular weight of 428.52 g/mol. Its IUPAC name is ethyl 7-[(1R,2R,3R,5S)-2-[3-(3,5-difluorophenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,2R,3R,5S)-2-[3-(3,5-difluorophenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59075700 |
| Molecular Formula | C23H34F2O5 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | ethyl 7-[(1R,2R,3R,5S)-2-[3-(3,5-difluorophenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | CCOC(=O)CCCCCC[C@@H]1[C@@H](CCC(O)c2cc(F)cc(F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H34F2O5/c1-2-30-23(29)8-6-4-3-5-7-18-19(22(28)14-21(18)27)9-10-20(26)15-11-16(24)13-17(25)12-15/h11-13,18-22,26-28H,2-10,14H2,1H3/t18-,19-,20?,21+,22-/m1/s1 |
| InChIKey | UZWHLKIDNBTEIK-NUIBLQIESA-N |
| XLogP | 4.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|