C22H32ClFO5 — CID 21132776
7-[2-[3-(5-chloro-4-fluoro-2-methylphenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 21132776) has the molecular formula C22H32ClFO5 and a molecular weight of 430.94 g/mol. Its IUPAC name is 7-[2-[3-(5-chloro-4-fluoro-2-methylphenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[3-(5-chloro-4-fluoro-2-methylphenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 21132776 |
| Molecular Formula | C22H32ClFO5 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 7-[2-[3-(5-chloro-4-fluoro-2-methylphenyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | Cc1cc(F)c(Cl)cc1C(O)CCC1C(O)CC(O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H32ClFO5/c1-13-10-18(24)17(23)11-16(13)19(25)9-8-15-14(20(26)12-21(15)27)6-4-2-3-5-7-22(28)29/h10-11,14-15,19-21,25-27H,2-9,12H2,1H3,(H,28,29) |
| InChIKey | LJXJWIFYDMXWDI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|