C24H32F2O5 — CID 59734613
7-[(1R,2R,3R,5S)-2-[6-(2,4-difluorophenyl)-3-hydroxyhexa-4,5-dienyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 59734613) has the molecular formula C24H32F2O5 and a molecular weight of 438.51 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[6-(2,4-difluorophenyl)-3-hydroxyhexa-4,5-dienyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[6-(2,4-difluorophenyl)-3-hydroxyhexa-4,5-dienyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59734613 |
| Molecular Formula | C24H32F2O5 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[6-(2,4-difluorophenyl)-3-hydroxyhexa-4,5-dienyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CCC(O)C=C=Cc2ccc(F)cc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C24H32F2O5/c25-17-11-10-16(21(26)14-17)6-5-7-18(27)12-13-20-19(22(28)15-23(20)29)8-3-1-2-4-9-24(30)31/h6-7,10-11,14,18-20,22-23,27-29H,1-4,8-9,12-13,15H2,(H,30,31)/t5?,18?,19-,20-,22+,23-/m1/s1 |
| InChIKey | KIQKYMUIOBXNQT-BOYCAEHKSA-N |
| XLogP | 4.06 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|