C22H32FNO6 — CID 70853074
7-[(1R,3R,5S)-2-[4-(2-fluoroanilino)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 70853074) has the molecular formula C22H32FNO6 and a molecular weight of 425.50 g/mol. Its IUPAC name is 7-[(1R,3R,5S)-2-[4-(2-fluoroanilino)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,3R,5S)-2-[4-(2-fluoroanilino)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70853074 |
| Molecular Formula | C22H32FNO6 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 7-[(1R,3R,5S)-2-[4-(2-fluoroanilino)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(CCC(O)C(=O)Nc2ccccc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C22H32FNO6/c23-16-8-5-6-9-17(16)24-22(30)18(25)12-11-15-14(19(26)13-20(15)27)7-3-1-2-4-10-21(28)29/h5-6,8-9,14-15,18-20,25-27H,1-4,7,10-13H2,(H,24,30)(H,28,29)/t14-,15?,18?,19+,20-/m1/s1 |
| InChIKey | XFJBCMKWJUMTRH-XXMPYHLRSA-N |
| XLogP | 2.69 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|