C23H33ClO6 — CID 23381872
7-[2-[4-(3-chloro-5-methylphenyl)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 23381872) has the molecular formula C23H33ClO6 and a molecular weight of 440.96 g/mol. Its IUPAC name is 7-[2-[4-(3-chloro-5-methylphenyl)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[4-(3-chloro-5-methylphenyl)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 23381872 |
| Molecular Formula | C23H33ClO6 |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 7-[2-[4-(3-chloro-5-methylphenyl)-3-hydroxy-4-oxobutyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | Cc1cc(Cl)cc(C(=O)C(O)CCC2C(O)CC(O)C2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C23H33ClO6/c1-14-10-15(12-16(24)11-14)23(30)19(25)9-8-18-17(20(26)13-21(18)27)6-4-2-3-5-7-22(28)29/h10-12,17-21,25-27H,2-9,13H2,1H3,(H,28,29) |
| InChIKey | OFKKYXCIPGTEPM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|