C26H35FO5 — CID 142015667
7-[(1R,3R,5S)-2-[3-(1-fluoronaphthalen-2-yl)-3-hydroxypropyl]-5-hydroxy-3-(hydroxymethyl)cyclopentyl]heptanoic acid (PubChem CID 142015667) has the molecular formula C26H35FO5 and a molecular weight of 446.56 g/mol. Its IUPAC name is 7-[(1R,3R,5S)-2-[3-(1-fluoronaphthalen-2-yl)-3-hydroxypropyl]-5-hydroxy-3-(hydroxymethyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,3R,5S)-2-[3-(1-fluoronaphthalen-2-yl)-3-hydroxypropyl]-5-hydroxy-3-(hydroxymethyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 142015667 |
| Molecular Formula | C26H35FO5 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 7-[(1R,3R,5S)-2-[3-(1-fluoronaphthalen-2-yl)-3-hydroxypropyl]-5-hydroxy-3-(hydroxymethyl)cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(CCC(O)c2ccc3ccccc3c2F)[C@H](CO)C[C@@H]1O |
| InChI | InChI=1S/C26H35FO5/c27-26-20-8-6-5-7-17(20)11-12-22(26)23(29)14-13-19-18(16-28)15-24(30)21(19)9-3-1-2-4-10-25(31)32/h5-8,11-12,18-19,21,23-24,28-30H,1-4,9-10,13-16H2,(H,31,32)/t18-,19?,21+,23?,24-/m0/s1 |
| InChIKey | NCMJRDLAFDMMFT-KPAJEBQJSA-N |
| XLogP | 4.82 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|