C23H36FNO5 — CID 126625970
propan-2-yl 7-[(3R,5S)-2-[3-(3-fluoro-4-pyridinyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 126625970) has the molecular formula C23H36FNO5 and a molecular weight of 425.54 g/mol. Its IUPAC name is propan-2-yl 7-[(3R,5S)-2-[3-(3-fluoro-4-pyridinyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(3R,5S)-2-[3-(3-fluoro-4-pyridinyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 126625970 |
| Molecular Formula | C23H36FNO5 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | propan-2-yl 7-[(3R,5S)-2-[3-(3-fluoro-4-pyridinyl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCC1C(CCC(O)c2ccncc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H36FNO5/c1-15(2)30-23(29)8-6-4-3-5-7-16-17(22(28)13-21(16)27)9-10-20(26)18-11-12-25-14-19(18)24/h11-12,14-17,20-22,26-28H,3-10,13H2,1-2H3/t16?,17?,20?,21-,22+/m0/s1 |
| InChIKey | KFZWHYMWTUKKNP-BNWPOONLSA-N |
| XLogP | 3.68 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|