C24H37FO5 — CID 146794550
methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxybutyl)cyclopentyl]-2-(4-fluoro-2-methylphenyl)heptanoate (PubChem CID 146794550) has the molecular formula C24H37FO5 and a molecular weight of 424.55 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxybutyl)cyclopentyl]-2-(4-fluoro-2-methylphenyl)heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxybutyl)cyclopentyl]-2-(4-fluoro-2-methylphenyl)heptanoate |
|---|---|
| PubChem CID | 146794550 |
| Molecular Formula | C24H37FO5 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxybutyl)cyclopentyl]-2-(4-fluoro-2-methylphenyl)heptanoate |
| SMILES | COC(=O)C(CCCCC[C@@H]1[C@@H](CCC(C)O)[C@H](O)C[C@@H]1O)c1ccc(F)cc1C |
| InChI | InChI=1S/C24H37FO5/c1-15-13-17(25)10-12-18(15)21(24(29)30-3)8-6-4-5-7-19-20(11-9-16(2)26)23(28)14-22(19)27/h10,12-13,16,19-23,26-28H,4-9,11,14H2,1-3H3/t16?,19-,20-,21?,22+,23-/m1/s1 |
| InChIKey | RWMQPUDEYNCRTR-KYYVMHFASA-N |
| XLogP | 3.86 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|