C23H34O5S — CID 54458275
methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-(4-methylphenyl)heptanoate (PubChem CID 54458275) has the molecular formula C23H34O5S and a molecular weight of 422.59 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-(4-methylphenyl)heptanoate.
| Compound Name | methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-(4-methylphenyl)heptanoate |
|---|---|
| PubChem CID | 54458275 |
| Molecular Formula | C23H34O5S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]-2-(4-methylphenyl)heptanoate |
| SMILES | COC(=O)C(CCCCC[C@H]1C(=O)CC(O)[C@@H]1SCC(C)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H34O5S/c1-15-9-11-17(12-10-15)18(23(27)28-3)7-5-4-6-8-19-20(25)13-21(26)22(19)29-14-16(2)24/h9-12,16,18-19,21-22,24,26H,4-8,13-14H2,1-3H3/t16?,18?,19-,21?,22+/m0/s1 |
| InChIKey | WZTDIBIUVNPYSO-VDBWJZHUSA-N |
| XLogP | 3.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|