C22H32O5S — CID 54558561
7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-4-phenylbutyl)sulfanyl-5-oxocyclopentyl]heptanoic acid (PubChem CID 54558561) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-4-phenylbutyl)sulfanyl-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-4-phenylbutyl)sulfanyl-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54558561 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-4-phenylbutyl)sulfanyl-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)CC(O)[C@@H]1SCC(O)CCc1ccccc1 |
| InChI | InChI=1S/C22H32O5S/c23-17(13-12-16-8-4-3-5-9-16)15-28-22-18(19(24)14-20(22)25)10-6-1-2-7-11-21(26)27/h3-5,8-9,17-18,20,22-23,25H,1-2,6-7,10-15H2,(H,26,27)/t17?,18-,20?,22+/m0/s1 |
| InChIKey | ZOXRWFOFFINESR-RXYWUWFVSA-N |
| XLogP | 3.46 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|