C25H32O5S — CID 22802389
7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-naphthalen-2-ylpropyl)sulfanyl-5-oxocyclopentyl]heptanoic acid (PubChem CID 22802389) has the molecular formula C25H32O5S and a molecular weight of 444.59 g/mol. Its IUPAC name is 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-naphthalen-2-ylpropyl)sulfanyl-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-naphthalen-2-ylpropyl)sulfanyl-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22802389 |
| Molecular Formula | C25H32O5S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-naphthalen-2-ylpropyl)sulfanyl-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(O)(CS[C@H]1C(O)CC(=O)[C@@H]1CCCCCCC(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H32O5S/c1-25(30,19-13-12-17-8-6-7-9-18(17)14-19)16-31-24-20(21(26)15-22(24)27)10-4-2-3-5-11-23(28)29/h6-9,12-14,20,22,24,27,30H,2-5,10-11,15-16H2,1H3,(H,28,29)/t20-,22?,24+,25?/m0/s1 |
| InChIKey | SBTXZJXCDHIQBS-AIKDJIOISA-N |
| XLogP | 4.52 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|