C34H47NO6S — CID 70552853
(4-benzamidophenyl) 7-[(1S,2R,3R)-3-hydroxy-2-(2-hydroxy-2,3-dimethylheptyl)sulfanyl-5-oxocyclopentyl]heptanoate (PubChem CID 70552853) has the molecular formula C34H47NO6S and a molecular weight of 597.82 g/mol. Its IUPAC name is (4-benzamidophenyl) 7-[(1S,2R,3R)-3-hydroxy-2-(2-hydroxy-2,3-dimethylheptyl)sulfanyl-5-oxocyclopentyl]heptanoate.
| Compound Name | (4-benzamidophenyl) 7-[(1S,2R,3R)-3-hydroxy-2-(2-hydroxy-2,3-dimethylheptyl)sulfanyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70552853 |
| Molecular Formula | C34H47NO6S |
| Molecular Weight | 597.82 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | (4-benzamidophenyl) 7-[(1S,2R,3R)-3-hydroxy-2-(2-hydroxy-2,3-dimethylheptyl)sulfanyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(C)C(C)(O)CS[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H47NO6S/c1-4-5-13-24(2)34(3,40)23-42-32-28(29(36)22-30(32)37)16-11-6-7-12-17-31(38)41-27-20-18-26(19-21-27)35-33(39)25-14-9-8-10-15-25/h8-10,14-15,18-21,24,28,30,32,37,40H,4-7,11-13,16-17,22-23H2,1-3H3,(H,35,39)/t24?,28-,30+,32+,34?/m0/s1 |
| InChIKey | UTKGBEGXVUARAV-FSJQAPGYSA-N |
| XLogP | 6.81 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.82 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|