C33H47NO6S — CID 54345941
(4-benzamidophenyl) 7-[(1S,2R,3R)-3,5-dihydroxy-2-(2-hydroxyheptylsulfanyl)cyclopentyl]-2-methylheptanoate (PubChem CID 54345941) has the molecular formula C33H47NO6S and a molecular weight of 585.81 g/mol. Its IUPAC name is (4-benzamidophenyl) 7-[(1S,2R,3R)-3,5-dihydroxy-2-(2-hydroxyheptylsulfanyl)cyclopentyl]-2-methylheptanoate.
| Compound Name | (4-benzamidophenyl) 7-[(1S,2R,3R)-3,5-dihydroxy-2-(2-hydroxyheptylsulfanyl)cyclopentyl]-2-methylheptanoate |
|---|---|
| PubChem CID | 54345941 |
| Molecular Formula | C33H47NO6S |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | (4-benzamidophenyl) 7-[(1S,2R,3R)-3,5-dihydroxy-2-(2-hydroxyheptylsulfanyl)cyclopentyl]-2-methylheptanoate |
| SMILES | CCCCCC(O)CS[C@H]1[C@H](O)CC(O)[C@@H]1CCCCCC(C)C(=O)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H47NO6S/c1-3-4-7-15-26(35)22-41-31-28(29(36)21-30(31)37)16-11-5-8-12-23(2)33(39)40-27-19-17-25(18-20-27)34-32(38)24-13-9-6-10-14-24/h6,9-10,13-14,17-20,23,26,28-31,35-37H,3-5,7-8,11-12,15-16,21-22H2,1-2H3,(H,34,38)/t23?,26?,28-,29?,30+,31+/m0/s1 |
| InChIKey | UCHYKVKKQMJFQC-JSOTWFLZSA-N |
| XLogP | 6.22 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|