About (4-benzamidophenyl) 2-acetamidopropanoate
(4-benzamidophenyl) 2-acetamidopropanoate (PubChem CID 78778854) has the molecular formula C18H18N2O4
and a molecular weight of 326.35 g/mol. Its IUPAC name is (4-benzamidophenyl) 2-acetamidopropanoate.
Molecular Properties
| Compound Name | (4-benzamidophenyl) 2-acetamidopropanoate |
| PubChem CID | 78778854 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (4-benzamidophenyl) 2-acetamidopropanoate |
| SMILES | CC(=O)NC(C)C(=O)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-12(19-13(2)21)18(23)24-16-10-8-15(9-11-16)20-17(22)14-6-4-3-5-7-14/h3-12H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | CPFWMJIDDHTELF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-benzamidophenyl) 2-acetamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzamidophenyl) 2-acetamidopropanoate?
The IUPAC name of (4-benzamidophenyl) 2-acetamidopropanoate (CID 78778854) is (4-benzamidophenyl) 2-acetamidopropanoate.
What is the SMILES notation for (4-benzamidophenyl) 2-acetamidopropanoate?
The canonical SMILES for (4-benzamidophenyl) 2-acetamidopropanoate is CC(=O)NC(C)C(=O)Oc1ccc(NC(=O)c2ccccc2)cc1.
What is the InChIKey of (4-benzamidophenyl) 2-acetamidopropanoate?
The InChIKey is CPFWMJIDDHTELF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4/c1-12(19-13(2)21)18(23)24-16-10-8-15(9-11-16)20-17(22)14-6-4-3-5-7-14/h3-12H,1-2H3,(H,19,21)(H,20,22).
What are the key properties of (4-benzamidophenyl) 2-acetamidopropanoate?
(4-benzamidophenyl) 2-acetamidopropanoate has a molecular weight of 326.35 g/mol, XLogP of 2.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzamidophenyl) 2-acetamidopropanoate is sourced from PubChem (CID 78778854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).