C25H22N2O5 — CID 55927240
[2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-benzamidopropanoate (PubChem CID 55927240) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-benzamidopropanoate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-benzamidopropanoate |
|---|---|
| PubChem CID | 55927240 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-benzamidopropanoate |
| SMILES | C[C@H](NC(=O)c1ccccc1)C(=O)OCC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O5/c1-17(26-23(29)19-8-4-2-5-9-19)25(31)32-16-22(28)18-12-14-21(15-13-18)27-24(30)20-10-6-3-7-11-20/h2-15,17H,16H2,1H3,(H,26,29)(H,27,30)/t17-/m0/s1 |
| InChIKey | ZURJONDEWOSKNV-KRWDZBQOSA-N |
| XLogP | 3.48 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |