C26H42FNO5S — CID 142089731
(1S,3R,4R,5R)-4-[4-(5-fluoro-2-sulfanylphenyl)imino-3-hydroxybutyl]-5-propylcyclopentane-1,3-diol;propan-2-yl pentanoate (PubChem CID 142089731) has the molecular formula C26H42FNO5S and a molecular weight of 499.69 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-[4-(5-fluoro-2-sulfanylphenyl)imino-3-hydroxybutyl]-5-propylcyclopentane-1,3-diol;propan-2-yl pentanoate.
| Compound Name | (1S,3R,4R,5R)-4-[4-(5-fluoro-2-sulfanylphenyl)imino-3-hydroxybutyl]-5-propylcyclopentane-1,3-diol;propan-2-yl pentanoate |
|---|---|
| PubChem CID | 142089731 |
| Molecular Formula | C26H42FNO5S |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | (1S,3R,4R,5R)-4-[4-(5-fluoro-2-sulfanylphenyl)imino-3-hydroxybutyl]-5-propylcyclopentane-1,3-diol;propan-2-yl pentanoate |
| SMILES | CCCCC(=O)OC(C)C.CCC[C@@H]1[C@@H](CCC(O)/C=N/c2cc(F)ccc2S)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C18H26FNO3S.C8H16O2/c1-2-3-13-14(17(23)9-16(13)22)6-5-12(21)10-20-15-8-11(19)4-7-18(15)24;1-4-5-6-8(9)10-7(2)3/h4,7-8,10,12-14,16-17,21-24H,2-3,5-6,9H2,1H3;7H,4-6H2,1-3H3/b20-10+;/t12?,13-,14-,16+,17-;/m1./s1 |
| InChIKey | DAEPUCZZKDAYBS-ZFKIHNRQSA-N |
| XLogP | 5.24 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|