C25H40O5S — CID 71057180
propan-2-yl 7-[(1R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate (PubChem CID 71057180) has the molecular formula C25H40O5S and a molecular weight of 452.66 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(1R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 71057180 |
| Molecular Formula | C25H40O5S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | propan-2-yl 7-[(1R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCC[C@@H]1C(CCC(O)CSc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H40O5S/c1-18(2)30-25(29)13-9-4-3-8-12-21-22(24(28)16-23(21)27)15-14-19(26)17-31-20-10-6-5-7-11-20/h5-7,10-11,18-19,21-24,26-28H,3-4,8-9,12-17H2,1-2H3/t19?,21-,22?,23+,24-/m1/s1 |
| InChIKey | KYMLOUKUUHQTFV-UEERZSOZSA-N |
| XLogP | 4.57 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|