C25H40O4S — CID 71073553
propan-2-yl 7-[(1S,3R)-3-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate (PubChem CID 71073553) has the molecular formula C25H40O4S and a molecular weight of 436.66 g/mol. Its IUPAC name is propan-2-yl 7-[(1S,3R)-3-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(1S,3R)-3-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 71073553 |
| Molecular Formula | C25H40O4S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | propan-2-yl 7-[(1S,3R)-3-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCC[C@H]1CC[C@@H](O)C1CCC(O)CSc1ccccc1 |
| InChI | InChI=1S/C25H40O4S/c1-19(2)29-25(28)13-9-4-3-6-10-20-14-17-24(27)23(20)16-15-21(26)18-30-22-11-7-5-8-12-22/h5,7-8,11-12,19-21,23-24,26-27H,3-4,6,9-10,13-18H2,1-2H3/t20-,21?,23?,24+/m0/s1 |
| InChIKey | AEXNMGKSELCRTA-QGQLOYOPSA-N |
| XLogP | 5.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|