C25H39NO4 — CID 67359668
propan-2-yl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbutyl]-6-oxopiperidin-1-yl]heptanoate (PubChem CID 67359668) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is propan-2-yl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbutyl]-6-oxopiperidin-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbutyl]-6-oxopiperidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 67359668 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | propan-2-yl 7-[(2R)-2-[(3R)-3-hydroxy-4-phenylbutyl]-6-oxopiperidin-1-yl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCN1C(=O)CCC[C@@H]1CC[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C25H39NO4/c1-20(2)30-25(29)15-8-3-4-9-18-26-22(13-10-14-24(26)28)16-17-23(27)19-21-11-6-5-7-12-21/h5-7,11-12,20,22-23,27H,3-4,8-10,13-19H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | LETUPPGTBNYITB-DHIUTWEWSA-N |
| XLogP | 4.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|