C21H31NO5 — CID 58804767
3-[3-[(2R)-2-(3-hydroxy-4-phenylbutyl)-6-oxopiperidin-1-yl]propoxy]propanoic acid (PubChem CID 58804767) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is 3-[3-[(2R)-2-(3-hydroxy-4-phenylbutyl)-6-oxopiperidin-1-yl]propoxy]propanoic acid.
| Compound Name | 3-[3-[(2R)-2-(3-hydroxy-4-phenylbutyl)-6-oxopiperidin-1-yl]propoxy]propanoic acid |
|---|---|
| PubChem CID | 58804767 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 3-[3-[(2R)-2-(3-hydroxy-4-phenylbutyl)-6-oxopiperidin-1-yl]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCCCN1C(=O)CCC[C@@H]1CCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO5/c23-19(16-17-6-2-1-3-7-17)11-10-18-8-4-9-20(24)22(18)13-5-14-27-15-12-21(25)26/h1-3,6-7,18-19,23H,4-5,8-16H2,(H,25,26)/t18-,19?/m1/s1 |
| InChIKey | VVJYPLPBUINGPS-MRTLOADZSA-N |
| XLogP | 2.63 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|