C23H31NO4 — CID 58828555
7-[2-(3-hydroxy-4-phenylbutyl)-7-oxoazepan-1-yl]hept-5-ynoic acid (PubChem CID 58828555) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 7-[2-(3-hydroxy-4-phenylbutyl)-7-oxoazepan-1-yl]hept-5-ynoic acid.
| Compound Name | 7-[2-(3-hydroxy-4-phenylbutyl)-7-oxoazepan-1-yl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 58828555 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 7-[2-(3-hydroxy-4-phenylbutyl)-7-oxoazepan-1-yl]hept-5-ynoic acid |
| SMILES | O=C(O)CCCC#CCN1C(=O)CCCCC1CCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO4/c25-21(18-19-10-4-3-5-11-19)16-15-20-12-7-8-13-22(26)24(20)17-9-2-1-6-14-23(27)28/h3-5,10-11,20-21,25H,1,6-8,12-18H2,(H,27,28) |
| InChIKey | ICNZYWSFLQIIPQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|