C21H31NO4S — CID 67317839
7-[(4S)-4-[(3R)-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]heptanoic acid (PubChem CID 67317839) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is 7-[(4S)-4-[(3R)-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]heptanoic acid.
| Compound Name | 7-[(4S)-4-[(3R)-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 67317839 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 7-[(4S)-4-[(3R)-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)SCC[C@@H]1CC[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO4S/c23-19(16-17-8-4-3-5-9-17)12-11-18-13-15-27-21(26)22(18)14-7-2-1-6-10-20(24)25/h3-5,8-9,18-19,23H,1-2,6-7,10-16H2,(H,24,25)/t18-,19+/m0/s1 |
| InChIKey | PLLZTXNTPRLKHM-RBUKOAKNSA-N |
| XLogP | 4.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|